|  | |
| Names | |
|---|---|
| IUPAC name (Z)-Octadec-9-en-1-ol | |
| Other names Octadecenol cis-9-Octadecen-1-ol | |
| Identifiers | |
| 3D model (Jmol) | |
| ChEBI | |
| ChemSpider | |
| ECHA InfoCard | 100.005.089 | 
| KEGG | |
| 
PubChem CID
 | |
| UNII | |
| 
 | |
| 
 | |
| Properties | |
| C18H36O | |
| Molar mass | 268.478 g/mol | 
| Density | 0.845-0.855 g/cm3 | 
| Melting point | 13 to 19 °C (55 to 66 °F; 286 to 292 K) | 
| Boiling point | 330 to 360 °C (626 to 680 °F; 603 to 633 K) | 
| Insoluble | |
| Hazards | |
| NFPA 704 | |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
|  (what is   ?) | |
| Infobox references | |
Oleyl alcohol, octadecenol, or cis-9-octadecen-1-ol, is an unsaturated fatty alcohol with the chemical formula C18H36O or CH3(CH2)7-CH=CH-(CH2)8OH.
It can be produced by the hydrogenation of oleic acid esters; which can be obtained naturally from beef fat, fish oil and in particular olive oil (from which it gains its name).
It has uses as a nonionic surfactant, emulsifier, emollient and thickener in skin creams, lotions and many other cosmetic products including shampoos and hair conditioners. It has also been investigated as a carrier for delivering medications through the skin or mucus membranes; particularly the lungs.