Sodium sorbate

Sodium sorbate

Names
IUPAC name sodium (2E,4E)-hexa-2,4-dienoate
Identifiers
CAS Number	7757-81-5 N
3D model (Jmol)	Interactive image
ChemSpider	4938659 Y
ECHA InfoCard	100.028.927
E number	E201 (preservatives)
PubChem	23665582
InChI InChI=1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; Y Key: LROWVYNUWKVTCU-STWYSWDKSA-M Y InChI=1/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; Key: LROWVYNUWKVTCU-ZCSOUONQBK
SMILES [Na+].[O-]C(=O)\C=C\C=C\C
Properties
Chemical formula	C6H7NaO2
Molar mass	134.10835 g/mol
Odor	hydrocarbon-like
Boiling point	233 °C (451 °F; 506 K)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N  (what is YN ?)
Infobox references

Sodium sorbate is the sodium salt of sorbic acid. Its formula is NaC₆H₇O₂ and systematic name is sodium (E,E)-hexa-2,4-dienoate.

It is a food additive with E-number E201.

Unlike other sorbic acid salts such as potassium sorbate (E202) and calcium sorbate (E203), the use of sodium sorbate as a food additive is not allowed in the EU due to potential genotoxic effects.